C18H21N3O5S — CID 137339744
(3aR,7aR)-2-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 137339744) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is (3aR,7aR)-2-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 137339744 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (3aR,7aR)-2-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | Cc1ccc(-n2cccn2)cc1S(=O)(=O)N1C[C@@H]2COCC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C18H21N3O5S/c1-13-3-4-15(21-7-2-6-19-21)9-16(13)27(24,25)20-10-14-11-26-8-5-18(14,12-20)17(22)23/h2-4,6-7,9,14H,5,8,10-12H2,1H3,(H,22,23)/t14-,18+/m1/s1 |
| InChIKey | FZJMRWHBEAVLLS-KDOFPFPSSA-N |
| XLogP | 1.29 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |