C34H47N7O5 — CID 137340170
(14R,17S)-14-benzyl-8-[(3,4-dimethoxyphenyl)methyl]-20-methyl-17-propan-2-yl-1,4,8,13,16,19,21-heptazabicyclo[16.3.0]henicosa-18,20-diene-3,12,15-trione (PubChem CID 137340170) has the molecular formula C34H47N7O5 and a molecular weight of 633.79 g/mol. Its IUPAC name is (14R,17S)-14-benzyl-8-[(3,4-dimethoxyphenyl)methyl]-20-methyl-17-propan-2-yl-1,4,8,13,16,19,21-heptazabicyclo[16.3.0]henicosa-18,20-diene-3,12,15-trione.
| Compound Name | (14R,17S)-14-benzyl-8-[(3,4-dimethoxyphenyl)methyl]-20-methyl-17-propan-2-yl-1,4,8,13,16,19,21-heptazabicyclo[16.3.0]henicosa-18,20-diene-3,12,15-trione |
|---|---|
| PubChem CID | 137340170 |
| Molecular Formula | C34H47N7O5 |
| Molecular Weight | 633.79 g/mol |
| Exact Mass | 633.36 |
| IUPAC Name | (14R,17S)-14-benzyl-8-[(3,4-dimethoxyphenyl)methyl]-20-methyl-17-propan-2-yl-1,4,8,13,16,19,21-heptazabicyclo[16.3.0]henicosa-18,20-diene-3,12,15-trione |
| SMILES | COc1ccc(CN2CCCNC(=O)Cn3nc(C)nc3[C@H](C(C)C)NC(=O)[C@@H](Cc3ccccc3)NC(=O)CCC2)cc1OC |
| InChI | InChI=1S/C34H47N7O5/c1-23(2)32-33-36-24(3)39-41(33)22-31(43)35-16-10-18-40(21-26-14-15-28(45-4)29(20-26)46-5)17-9-13-30(42)37-27(34(44)38-32)19-25-11-7-6-8-12-25/h6-8,11-12,14-15,20,23,27,32H,9-10,13,16-19,21-22H2,1-5H3,(H,35,43)(H,37,42)(H,38,44)/t27-,32+/m1/s1 |
| InChIKey | VMQOKJWFTFUXMN-ZUKKLESISA-N |
| XLogP | 2.95 |
| TPSA | 139.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.79 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |