C17H26N4O2S — CID 137340989
(3S,8aS)-2-[2-[(1S)-1-amino-3-methylbutyl]-1,3-thiazole-4-carbonyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 137340989) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is (3S,8aS)-2-[2-[(1S)-1-amino-3-methylbutyl]-1,3-thiazole-4-carbonyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (3S,8aS)-2-[2-[(1S)-1-amino-3-methylbutyl]-1,3-thiazole-4-carbonyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 137340989 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (3S,8aS)-2-[2-[(1S)-1-amino-3-methylbutyl]-1,3-thiazole-4-carbonyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | CC(C)C[C@H](N)c1nc(C(=O)N2C[C@@H]3CCCN3C(=O)[C@@H]2C)cs1 |
| InChI | InChI=1S/C17H26N4O2S/c1-10(2)7-13(18)15-19-14(9-24-15)17(23)21-8-12-5-4-6-20(12)16(22)11(21)3/h9-13H,4-8,18H2,1-3H3/t11-,12-,13-/m0/s1 |
| InChIKey | IEGYARDXBWTAGE-AVGNSLFASA-N |
| XLogP | 2.02 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |