C20H26FN3O2 — CID 137341589
[(3aR,7aR)-2-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol (PubChem CID 137341589) has the molecular formula C20H26FN3O2 and a molecular weight of 359.45 g/mol. Its IUPAC name is [(3aR,7aR)-2-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol.
| Compound Name | [(3aR,7aR)-2-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
|---|---|
| PubChem CID | 137341589 |
| Molecular Formula | C20H26FN3O2 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | [(3aR,7aR)-2-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
| SMILES | Cc1cc(C)n(-c2ccc(F)cc2CN2C[C@@H]3COCC[C@]3(CO)C2)n1 |
| InChI | InChI=1S/C20H26FN3O2/c1-14-7-15(2)24(22-14)19-4-3-18(21)8-16(19)9-23-10-17-11-26-6-5-20(17,12-23)13-25/h3-4,7-8,17,25H,5-6,9-13H2,1-2H3/t17-,20-/m1/s1 |
| InChIKey | VPRPZWCQTXKQDG-YLJYHZDGSA-N |
| XLogP | 2.46 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |