C22H31N3O3 — CID 137341590
4-[(3S)-3-benzyl-5-oxopiperazin-1-yl]-N-cyclohexyl-N-methyl-4-oxobutanamide (PubChem CID 137341590) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 4-[(3S)-3-benzyl-5-oxopiperazin-1-yl]-N-cyclohexyl-N-methyl-4-oxobutanamide.
| Compound Name | 4-[(3S)-3-benzyl-5-oxopiperazin-1-yl]-N-cyclohexyl-N-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 137341590 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 4-[(3S)-3-benzyl-5-oxopiperazin-1-yl]-N-cyclohexyl-N-methyl-4-oxobutanamide |
| SMILES | CN(C(=O)CCC(=O)N1CC(=O)N[C@@H](Cc2ccccc2)C1)C1CCCCC1 |
| InChI | InChI=1S/C22H31N3O3/c1-24(19-10-6-3-7-11-19)21(27)12-13-22(28)25-15-18(23-20(26)16-25)14-17-8-4-2-5-9-17/h2,4-5,8-9,18-19H,3,6-7,10-16H2,1H3,(H,23,26)/t18-/m0/s1 |
| InChIKey | PDTLZJPLPOBQHM-SFHVURJKSA-N |
| XLogP | 2.13 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |