C18H21FN2O2 — CID 137342768
[(3aR,7aR)-2-[(8-fluoroquinolin-2-yl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol (PubChem CID 137342768) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is [(3aR,7aR)-2-[(8-fluoroquinolin-2-yl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol.
| Compound Name | [(3aR,7aR)-2-[(8-fluoroquinolin-2-yl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
|---|---|
| PubChem CID | 137342768 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | [(3aR,7aR)-2-[(8-fluoroquinolin-2-yl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
| SMILES | OC[C@]12CCOC[C@H]1CN(Cc1ccc3cccc(F)c3n1)C2 |
| InChI | InChI=1S/C18H21FN2O2/c19-16-3-1-2-13-4-5-15(20-17(13)16)9-21-8-14-10-23-7-6-18(14,11-21)12-22/h1-5,14,22H,6-12H2/t14-,18-/m1/s1 |
| InChIKey | PIXWNCFAIQSWAJ-RDTXWAMCSA-N |
| XLogP | 2.20 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |