C15H22N4O4 — CID 137342857
(3aR,7aR)-2-[2-[(1,3-dimethylpyrazol-4-yl)amino]-2-oxoethyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 137342857) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is (3aR,7aR)-2-[2-[(1,3-dimethylpyrazol-4-yl)amino]-2-oxoethyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-[2-[(1,3-dimethylpyrazol-4-yl)amino]-2-oxoethyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 137342857 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (3aR,7aR)-2-[2-[(1,3-dimethylpyrazol-4-yl)amino]-2-oxoethyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | Cc1nn(C)cc1NC(=O)CN1C[C@@H]2COCC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C15H22N4O4/c1-10-12(6-18(2)17-10)16-13(20)7-19-5-11-8-23-4-3-15(11,9-19)14(21)22/h6,11H,3-5,7-9H2,1-2H3,(H,16,20)(H,21,22)/t11-,15+/m1/s1 |
| InChIKey | LDDWMIDQCYVMMU-ABAIWWIYSA-N |
| XLogP | 0.09 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |