About 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)acetamide
2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)acetamide (PubChem CID 137343230) has the molecular formula C12H15N5O4
and a molecular weight of 293.28 g/mol. Its IUPAC name is 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)acetamide.
Molecular Properties
| Compound Name | 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)acetamide |
| PubChem CID | 137343230 |
| Molecular Formula | C12H15N5O4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)N(CCO)Cc1ncc[nH]1 |
| InChI | InChI=1S/C12H15N5O4/c18-6-5-16(7-9-13-2-3-14-9)11(20)8-17-4-1-10(19)15-12(17)21/h1-4,18H,5-8H2,(H,13,14)(H,15,19,21) |
| InChIKey | VBAKYBVGKKFZPP-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 124.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)acetamide?
The IUPAC name of 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)acetamide (CID 137343230) is 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)acetamide.
What is the SMILES notation for 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)acetamide?
The canonical SMILES for 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)acetamide is O=C(Cn1ccc(=O)[nH]c1=O)N(CCO)Cc1ncc[nH]1.
What is the InChIKey of 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)acetamide?
The InChIKey is VBAKYBVGKKFZPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5O4/c18-6-5-16(7-9-13-2-3-14-9)11(20)8-17-4-1-10(19)15-12(17)21/h1-4,18H,5-8H2,(H,13,14)(H,15,19,21).
What are the key properties of 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)acetamide?
2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)acetamide has a molecular weight of 293.28 g/mol, XLogP of -1.72, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)acetamide is sourced from PubChem (CID 137343230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).