C24H22ClN3O2 — CID 137343633
(3R,8aR)-2-[2-(4-chlorophenyl)quinoline-4-carbonyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 137343633) has the molecular formula C24H22ClN3O2 and a molecular weight of 419.91 g/mol. Its IUPAC name is (3R,8aR)-2-[2-(4-chlorophenyl)quinoline-4-carbonyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (3R,8aR)-2-[2-(4-chlorophenyl)quinoline-4-carbonyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 137343633 |
| Molecular Formula | C24H22ClN3O2 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (3R,8aR)-2-[2-(4-chlorophenyl)quinoline-4-carbonyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | C[C@@H]1C(=O)N2CCC[C@@H]2CN1C(=O)c1cc(-c2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C24H22ClN3O2/c1-15-23(29)27-12-4-5-18(27)14-28(15)24(30)20-13-22(16-8-10-17(25)11-9-16)26-21-7-3-2-6-19(20)21/h2-3,6-11,13,15,18H,4-5,12,14H2,1H3/t15-,18-/m1/s1 |
| InChIKey | KNZKZJPNEZYRMU-CRAIPNDOSA-N |
| XLogP | 4.39 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |