C18H27N5O — CID 137343779
N-[5-[(R)-amino(phenyl)methyl]-1,3,4-oxadiazol-2-yl]-N'-cyclopentyl-N'-methylpropane-1,3-diamine (PubChem CID 137343779) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is N-[5-[(R)-amino(phenyl)methyl]-1,3,4-oxadiazol-2-yl]-N'-cyclopentyl-N'-methylpropane-1,3-diamine.
| Compound Name | N-[5-[(R)-amino(phenyl)methyl]-1,3,4-oxadiazol-2-yl]-N'-cyclopentyl-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 137343779 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | N-[5-[(R)-amino(phenyl)methyl]-1,3,4-oxadiazol-2-yl]-N'-cyclopentyl-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCNc1nnc([C@H](N)c2ccccc2)o1)C1CCCC1 |
| InChI | InChI=1S/C18H27N5O/c1-23(15-10-5-6-11-15)13-7-12-20-18-22-21-17(24-18)16(19)14-8-3-2-4-9-14/h2-4,8-9,15-16H,5-7,10-13,19H2,1H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | REBGQGQCATWZST-MRXNPFEDSA-N |
| XLogP | 2.79 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|