C18H23ClN2O4 — CID 137344646
(3aR,7aR)-2-[3-[(2-chlorophenyl)methylamino]-3-oxopropyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 137344646) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is (3aR,7aR)-2-[3-[(2-chlorophenyl)methylamino]-3-oxopropyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-[3-[(2-chlorophenyl)methylamino]-3-oxopropyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 137344646 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (3aR,7aR)-2-[3-[(2-chlorophenyl)methylamino]-3-oxopropyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | O=C(CCN1C[C@@H]2COCC[C@]2(C(=O)O)C1)NCc1ccccc1Cl |
| InChI | InChI=1S/C18H23ClN2O4/c19-15-4-2-1-3-13(15)9-20-16(22)5-7-21-10-14-11-25-8-6-18(14,12-21)17(23)24/h1-4,14H,5-12H2,(H,20,22)(H,23,24)/t14-,18+/m1/s1 |
| InChIKey | NRYFWSZVDPUELV-KDOFPFPSSA-N |
| XLogP | 1.77 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |