C18H23N3O4S — CID 137345515
[(3aR,7aR)-2-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol (PubChem CID 137345515) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is [(3aR,7aR)-2-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol.
| Compound Name | [(3aR,7aR)-2-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
|---|---|
| PubChem CID | 137345515 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | [(3aR,7aR)-2-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
| SMILES | Cc1ccc(-n2cccn2)cc1S(=O)(=O)N1C[C@@H]2COCC[C@]2(CO)C1 |
| InChI | InChI=1S/C18H23N3O4S/c1-14-3-4-16(21-7-2-6-19-21)9-17(14)26(23,24)20-10-15-11-25-8-5-18(15,12-20)13-22/h2-4,6-7,9,15,22H,5,8,10-13H2,1H3/t15-,18-/m1/s1 |
| InChIKey | HEDWQNNSZOZKAM-CRAIPNDOSA-N |
| XLogP | 1.20 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |