C5H9N3O13 — CID 137346158
[1,3-dihydroxy-2,2-bis(hydroxymethyl)-1,3-dinitrooxypropyl] nitrate (PubChem CID 137346158) has the molecular formula C5H9N3O13 and a molecular weight of 319.14 g/mol. Its IUPAC name is [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1,3-dinitrooxypropyl] nitrate.
| Compound Name | [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1,3-dinitrooxypropyl] nitrate |
|---|---|
| PubChem CID | 137346158 |
| Molecular Formula | C5H9N3O13 |
| Molecular Weight | 319.14 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1,3-dinitrooxypropyl] nitrate |
| SMILES | O=[N+]([O-])OC(O)C(CO)(CO)C(O)(O[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C5H9N3O13/c9-1-4(2-10,3(11)19-6(13)14)5(12,20-7(15)16)21-8(17)18/h3,9-12H,1-2H2 |
| InChIKey | DPEUSNBDOYQRJC-UHFFFAOYSA-N |
| XLogP | -3.45 |
| TPSA | 238.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.14 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|