C23H23N3O2 — CID 137346271
2-amino-7,7-dimethyl-5-oxo-4-(1-prop-2-enylindol-3-yl)-6,8-dihydro-4H-chromene-3-carbonitrile (PubChem CID 137346271) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-amino-7,7-dimethyl-5-oxo-4-(1-prop-2-enylindol-3-yl)-6,8-dihydro-4H-chromene-3-carbonitrile.
| Compound Name | 2-amino-7,7-dimethyl-5-oxo-4-(1-prop-2-enylindol-3-yl)-6,8-dihydro-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 137346271 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-amino-7,7-dimethyl-5-oxo-4-(1-prop-2-enylindol-3-yl)-6,8-dihydro-4H-chromene-3-carbonitrile |
| SMILES | C=CCn1cc(C2C(C#N)=C(N)OC3=C2C(=O)CC(C)(C)C3)c2ccccc21 |
| InChI | InChI=1S/C23H23N3O2/c1-4-9-26-13-16(14-7-5-6-8-17(14)26)20-15(12-24)22(25)28-19-11-23(2,3)10-18(27)21(19)20/h4-8,13,20H,1,9-11,25H2,2-3H3 |
| InChIKey | WGOMWURNQVJNNM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|