C33H25ClN4O2 — CID 137346450
4-(4-chlorophenyl)-6-[7-(diethylamino)-2-oxochromen-3-yl]-2-(1H-indol-3-yl)pyridine-3-carbonitrile (PubChem CID 137346450) has the molecular formula C33H25ClN4O2 and a molecular weight of 545.04 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-6-[7-(diethylamino)-2-oxochromen-3-yl]-2-(1H-indol-3-yl)pyridine-3-carbonitrile.
| Compound Name | 4-(4-chlorophenyl)-6-[7-(diethylamino)-2-oxochromen-3-yl]-2-(1H-indol-3-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 137346450 |
| Molecular Formula | C33H25ClN4O2 |
| Molecular Weight | 545.04 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | 4-(4-chlorophenyl)-6-[7-(diethylamino)-2-oxochromen-3-yl]-2-(1H-indol-3-yl)pyridine-3-carbonitrile |
| SMILES | CCN(CC)c1ccc2cc(-c3cc(-c4ccc(Cl)cc4)c(C#N)c(-c4c[nH]c5ccccc45)n3)c(=O)oc2c1 |
| InChI | InChI=1S/C33H25ClN4O2/c1-3-38(4-2)23-14-11-21-15-26(33(39)40-31(21)16-23)30-17-25(20-9-12-22(34)13-10-20)27(18-35)32(37-30)28-19-36-29-8-6-5-7-24(28)29/h5-17,19,36H,3-4H2,1-2H3 |
| InChIKey | JGCYXCGUPZGJLN-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 85.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.04 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|