C6H11NO2S — CID 137346896
methyl (2S,4R)-4-sulfanylpyrrolidine-2-carboxylate (PubChem CID 137346896) has the molecular formula C6H11NO2S and a molecular weight of 161.23 g/mol. Its IUPAC name is methyl (2S,4R)-4-sulfanylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-4-sulfanylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 137346896 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | methyl (2S,4R)-4-sulfanylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](S)CN1 |
| InChI | InChI=1S/C6H11NO2S/c1-9-6(8)5-2-4(10)3-7-5/h4-5,7,10H,2-3H2,1H3/t4-,5+/m1/s1 |
| InChIKey | LDAXEFKQVFCZJY-UHNVWZDZSA-N |
| XLogP | -0.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|