C26H31N3O2 — CID 137347807
(4aR,5aS,8aR,13aS,15aS,15bR)-10-piperidin-1-yl-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one (PubChem CID 137347807) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is (4aR,5aS,8aR,13aS,15aS,15bR)-10-piperidin-1-yl-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one.
| Compound Name | (4aR,5aS,8aR,13aS,15aS,15bR)-10-piperidin-1-yl-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one |
|---|---|
| PubChem CID | 137347807 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | (4aR,5aS,8aR,13aS,15aS,15bR)-10-piperidin-1-yl-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one |
| SMILES | O=C1C[C@@H]2OCC=C3CN4CC[C@]56c7cc(N8CCCCC8)ccc7N1[C@H]5[C@H]2[C@H]3C[C@H]46 |
| InChI | InChI=1S/C26H31N3O2/c30-23-14-21-24-18-13-22-26(7-10-28(22)15-16(18)6-11-31-21)19-12-17(27-8-2-1-3-9-27)4-5-20(19)29(23)25(24)26/h4-6,12,18,21-22,24-25H,1-3,7-11,13-15H2/t18-,21-,22-,24-,25-,26+/m0/s1 |
| InChIKey | ISZWTEFIAGNWLU-PUJFWMPQSA-N |
| XLogP | 3.08 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|