C29H38N7O3S+ — CID 137347918
[(4S,5S)-4-[[(3S,6S,8aR)-6-amino-6-benzyl-5-oxo-1,2,3,7,8,8a-hexahydroindolizine-3-carbonyl]amino]-5-(1,3-benzothiazol-2-yl)-5-hydroxypentyl]-(diaminomethylidene)azanium (PubChem CID 137347918) has the molecular formula C29H38N7O3S+ and a molecular weight of 564.74 g/mol. Its IUPAC name is [(4S,5S)-4-[[(3S,6S,8aR)-6-amino-6-benzyl-5-oxo-1,2,3,7,8,8a-hexahydroindolizine-3-carbonyl]amino]-5-(1,3-benzothiazol-2-yl)-5-hydroxypentyl]-(diaminomethylidene)azanium.
| Compound Name | [(4S,5S)-4-[[(3S,6S,8aR)-6-amino-6-benzyl-5-oxo-1,2,3,7,8,8a-hexahydroindolizine-3-carbonyl]amino]-5-(1,3-benzothiazol-2-yl)-5-hydroxypentyl]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 137347918 |
| Molecular Formula | C29H38N7O3S+ |
| Molecular Weight | 564.74 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | [(4S,5S)-4-[[(3S,6S,8aR)-6-amino-6-benzyl-5-oxo-1,2,3,7,8,8a-hexahydroindolizine-3-carbonyl]amino]-5-(1,3-benzothiazol-2-yl)-5-hydroxypentyl]-(diaminomethylidene)azanium |
| SMILES | NC(N)=[NH+]CCC[C@H](NC(=O)[C@@H]1CC[C@@H]2CC[C@](N)(Cc3ccccc3)C(=O)N21)[C@H](O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C29H37N7O3S/c30-28(31)33-16-6-10-21(24(37)26-35-20-9-4-5-11-23(20)40-26)34-25(38)22-13-12-19-14-15-29(32,27(39)36(19)22)17-18-7-2-1-3-8-18/h1-5,7-9,11,19,21-22,24,37H,6,10,12-17,32H2,(H,34,38)(H4,30,31,33)/p+1/t19-,21+,22+,24+,29+/m1/s1 |
| InChIKey | DKILHAQNHIMEGI-ICSWELKVSA-O |
| XLogP | 0.04 |
| TPSA | 174.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.74 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|