C25H24N5O3+ — CID 137348004
2-ethyl-13-[2-(1-hydroxyquinolin-1-ium-4-yl)oxyethyl]-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one (PubChem CID 137348004) has the molecular formula C25H24N5O3+ and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-ethyl-13-[2-(1-hydroxyquinolin-1-ium-4-yl)oxyethyl]-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one.
| Compound Name | 2-ethyl-13-[2-(1-hydroxyquinolin-1-ium-4-yl)oxyethyl]-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
|---|---|
| PubChem CID | 137348004 |
| Molecular Formula | C25H24N5O3+ |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-ethyl-13-[2-(1-hydroxyquinolin-1-ium-4-yl)oxyethyl]-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
| SMILES | CCN1c2ncc(CCOc3cc[n+](O)c4ccccc34)cc2C(=O)N(C)c2cccnc21 |
| InChI | InChI=1S/C25H24N5O3/c1-3-29-23-19(25(31)28(2)21-9-6-12-26-24(21)29)15-17(16-27-23)11-14-33-22-10-13-30(32)20-8-5-4-7-18(20)22/h4-10,12-13,15-16,32H,3,11,14H2,1-2H3/q+1 |
| InChIKey | BPKNIYRRCFNZTI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|