About N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]ethanesulfonamide
N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]ethanesulfonamide (PubChem CID 137348015) has the molecular formula C15H21Cl2N3O4S
and a molecular weight of 410.32 g/mol. Its IUPAC name is N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]ethanesulfonamide.
Molecular Properties
| Compound Name | N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]ethanesulfonamide |
| PubChem CID | 137348015 |
| Molecular Formula | C15H21Cl2N3O4S |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC1CCN(C(=O)CNc2cc(Cl)c(Cl)cc2O)CC1 |
| InChI | InChI=1S/C15H21Cl2N3O4S/c1-2-25(23,24)19-10-3-5-20(6-4-10)15(22)9-18-13-7-11(16)12(17)8-14(13)21/h7-8,10,18-19,21H,2-6,9H2,1H3 |
| InChIKey | RIUWVQAWHOOGFK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]ethanesulfonamide?
The IUPAC name of N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]ethanesulfonamide (CID 137348015) is N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]ethanesulfonamide.
What is the SMILES notation for N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]ethanesulfonamide?
The canonical SMILES for N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]ethanesulfonamide is CCS(=O)(=O)NC1CCN(C(=O)CNc2cc(Cl)c(Cl)cc2O)CC1.
What is the InChIKey of N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]ethanesulfonamide?
The InChIKey is RIUWVQAWHOOGFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21Cl2N3O4S/c1-2-25(23,24)19-10-3-5-20(6-4-10)15(22)9-18-13-7-11(16)12(17)8-14(13)21/h7-8,10,18-19,21H,2-6,9H2,1H3.
What are the key properties of N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]ethanesulfonamide?
N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]ethanesulfonamide has a molecular weight of 410.32 g/mol, XLogP of 2.04, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]ethanesulfonamide is sourced from PubChem (CID 137348015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).