C12H13N3O4 — CID 137348123
(2S)-2-amino-4-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)butanoic acid (PubChem CID 137348123) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is (2S)-2-amino-4-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)butanoic acid.
| Compound Name | (2S)-2-amino-4-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)butanoic acid |
|---|---|
| PubChem CID | 137348123 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | (2S)-2-amino-4-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)butanoic acid |
| SMILES | N[C@@H](CCc1ccc2[nH]c(=O)c(=O)[nH]c2c1)C(=O)O |
| InChI | InChI=1S/C12H13N3O4/c13-7(12(18)19)3-1-6-2-4-8-9(5-6)15-11(17)10(16)14-8/h2,4-5,7H,1,3,13H2,(H,14,16)(H,15,17)(H,18,19)/t7-/m0/s1 |
| InChIKey | HOBORVHHDCBXLX-ZETCQYMHSA-N |
| XLogP | -0.44 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|