About 5-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2,3-dihydroinden-1-one
5-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2,3-dihydroinden-1-one (PubChem CID 137348519) has the molecular formula C21H20N2O4
and a molecular weight of 364.40 g/mol. Its IUPAC name is 5-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 5-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2,3-dihydroinden-1-one |
| PubChem CID | 137348519 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 5-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cc(N3CCN(C(=O)c4ccc5c(c4)OCO5)CC3)ccc21 |
| InChI | InChI=1S/C21H20N2O4/c24-18-5-1-14-11-16(3-4-17(14)18)22-7-9-23(10-8-22)21(25)15-2-6-19-20(12-15)27-13-26-19/h2-4,6,11-12H,1,5,7-10,13H2 |
| InChIKey | JAFWBQRYWNPFPG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2,3-dihydroinden-1-one?
The IUPAC name of 5-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2,3-dihydroinden-1-one (CID 137348519) is 5-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2,3-dihydroinden-1-one.
What is the SMILES notation for 5-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2,3-dihydroinden-1-one?
The canonical SMILES for 5-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2,3-dihydroinden-1-one is O=C1CCc2cc(N3CCN(C(=O)c4ccc5c(c4)OCO5)CC3)ccc21.
What is the InChIKey of 5-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2,3-dihydroinden-1-one?
The InChIKey is JAFWBQRYWNPFPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O4/c24-18-5-1-14-11-16(3-4-17(14)18)22-7-9-23(10-8-22)21(25)15-2-6-19-20(12-15)27-13-26-19/h2-4,6,11-12H,1,5,7-10,13H2.
What are the key properties of 5-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2,3-dihydroinden-1-one?
5-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2,3-dihydroinden-1-one has a molecular weight of 364.40 g/mol, XLogP of 2.51, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2,3-dihydroinden-1-one is sourced from PubChem (CID 137348519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).