C12H21N4O7P2S+ — CID 137348706
2-[(5S)-3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-2,5-dihydro-1,3-thiazol-3-ium-5-yl]ethyl phosphono hydrogen phosphate (PubChem CID 137348706) has the molecular formula C12H21N4O7P2S+ and a molecular weight of 427.34 g/mol. Its IUPAC name is 2-[(5S)-3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-2,5-dihydro-1,3-thiazol-3-ium-5-yl]ethyl phosphono hydrogen phosphate.
| Compound Name | 2-[(5S)-3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-2,5-dihydro-1,3-thiazol-3-ium-5-yl]ethyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 137348706 |
| Molecular Formula | C12H21N4O7P2S+ |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 2-[(5S)-3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-2,5-dihydro-1,3-thiazol-3-ium-5-yl]ethyl phosphono hydrogen phosphate |
| SMILES | CC1=[N+](Cc2cnc(C)nc2N)CS[C@H]1CCOP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C12H20N4O7P2S/c1-8-11(3-4-22-25(20,21)23-24(17,18)19)26-7-16(8)6-10-5-14-9(2)15-12(10)13/h5,11H,3-4,6-7H2,1-2H3,(H4-,13,14,15,17,18,19,20,21)/p+1/t11-/m0/s1 |
| InChIKey | FAOXQWUECSMMCY-NSHDSACASA-O |
| XLogP | 1.03 |
| TPSA | 168.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|