C11H17FNO7+ — CID 137348857
(2R,3R,4R,5R)-3-acetamido-2-[(1R)-1,3-dihydroxypropyl]-5-fluoro-4-hydroxy-2,3,4,5-tetrahydropyran-1-ium-6-carboxylic acid (PubChem CID 137348857) has the molecular formula C11H17FNO7+ and a molecular weight of 294.26 g/mol. Its IUPAC name is (2R,3R,4R,5R)-3-acetamido-2-[(1R)-1,3-dihydroxypropyl]-5-fluoro-4-hydroxy-2,3,4,5-tetrahydropyran-1-ium-6-carboxylic acid.
| Compound Name | (2R,3R,4R,5R)-3-acetamido-2-[(1R)-1,3-dihydroxypropyl]-5-fluoro-4-hydroxy-2,3,4,5-tetrahydropyran-1-ium-6-carboxylic acid |
|---|---|
| PubChem CID | 137348857 |
| Molecular Formula | C11H17FNO7+ |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (2R,3R,4R,5R)-3-acetamido-2-[(1R)-1,3-dihydroxypropyl]-5-fluoro-4-hydroxy-2,3,4,5-tetrahydropyran-1-ium-6-carboxylic acid |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@@H](F)C(C(=O)O)=[O+][C@H]1[C@H](O)CCO |
| InChI | InChI=1S/C11H16FNO7/c1-4(15)13-7-8(17)6(12)10(11(18)19)20-9(7)5(16)2-3-14/h5-9,14,16-17H,2-3H2,1H3,(H-,13,15,18,19)/p+1/t5-,6-,7-,8+,9+/m1/s1 |
| InChIKey | CHPKCUSAUNABPC-HXLXBVJFSA-O |
| XLogP | -2.49 |
| TPSA | 138.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|