C16H20BNO5 — CID 137349056
(3R)-3-(cyclohexanecarbonylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 137349056) has the molecular formula C16H20BNO5 and a molecular weight of 317.15 g/mol. Its IUPAC name is (3R)-3-(cyclohexanecarbonylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-(cyclohexanecarbonylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 137349056 |
| Molecular Formula | C16H20BNO5 |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (3R)-3-(cyclohexanecarbonylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1OB(O)[C@@H](NC(=O)C1CCCCC1)C2 |
| InChI | InChI=1S/C16H20BNO5/c19-15(10-5-2-1-3-6-10)18-13-9-11-7-4-8-12(16(20)21)14(11)23-17(13)22/h4,7-8,10,13,22H,1-3,5-6,9H2,(H,18,19)(H,20,21)/t13-/m0/s1 |
| InChIKey | ZRHUJXRVIMMHFG-ZDUSSCGKSA-N |
| XLogP | 1.40 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|