About 1-[3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]azetidin-1-yl]propan-1-one
1-[3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]azetidin-1-yl]propan-1-one (PubChem CID 137349063) has the molecular formula C18H24Cl2N4O3
and a molecular weight of 415.32 g/mol. Its IUPAC name is 1-[3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]azetidin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]azetidin-1-yl]propan-1-one |
| PubChem CID | 137349063 |
| Molecular Formula | C18H24Cl2N4O3 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-[3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]azetidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CC(N2CCN(C(=O)CNc3cc(Cl)c(Cl)cc3O)CC2)C1 |
| InChI | InChI=1S/C18H24Cl2N4O3/c1-2-17(26)24-10-12(11-24)22-3-5-23(6-4-22)18(27)9-21-15-7-13(19)14(20)8-16(15)25/h7-8,12,21,25H,2-6,9-11H2,1H3 |
| InChIKey | JZGAPYVXPKOQIL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]azetidin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]azetidin-1-yl]propan-1-one?
The IUPAC name of 1-[3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]azetidin-1-yl]propan-1-one (CID 137349063) is 1-[3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]azetidin-1-yl]propan-1-one.
What is the SMILES notation for 1-[3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]azetidin-1-yl]propan-1-one?
The canonical SMILES for 1-[3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]azetidin-1-yl]propan-1-one is CCC(=O)N1CC(N2CCN(C(=O)CNc3cc(Cl)c(Cl)cc3O)CC2)C1.
What is the InChIKey of 1-[3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]azetidin-1-yl]propan-1-one?
The InChIKey is JZGAPYVXPKOQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24Cl2N4O3/c1-2-17(26)24-10-12(11-24)22-3-5-23(6-4-22)18(27)9-21-15-7-13(19)14(20)8-16(15)25/h7-8,12,21,25H,2-6,9-11H2,1H3.
What are the key properties of 1-[3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]azetidin-1-yl]propan-1-one?
1-[3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]azetidin-1-yl]propan-1-one has a molecular weight of 415.32 g/mol, XLogP of 1.88, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]azetidin-1-yl]propan-1-one is sourced from PubChem (CID 137349063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).