C21H21N3O5 — CID 137349102
(2S,3R,4R,5S,6R)-2-[3-(9H-fluoren-2-yl)-1H-1,2,4-triazol-5-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 137349102) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-(9H-fluoren-2-yl)-1H-1,2,4-triazol-5-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-(9H-fluoren-2-yl)-1H-1,2,4-triazol-5-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 137349102 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-(9H-fluoren-2-yl)-1H-1,2,4-triazol-5-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2nc(-c3ccc4c(c3)Cc3ccccc3-4)n[nH]2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H21N3O5/c25-9-15-16(26)17(27)18(28)19(29-15)21-22-20(23-24-21)11-5-6-14-12(8-11)7-10-3-1-2-4-13(10)14/h1-6,8,15-19,25-28H,7,9H2,(H,22,23,24)/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | TZDHXEVIRUMISB-UJWQCDCRSA-N |
| XLogP | 0.56 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |