C20H24N2O4S — CID 137349191
(2S)-4-[[(5S)-5-amino-6-oxohexyl]amino]-2-naphthalen-2-ylsulfanyl-4-oxobutanoic acid (PubChem CID 137349191) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is (2S)-4-[[(5S)-5-amino-6-oxohexyl]amino]-2-naphthalen-2-ylsulfanyl-4-oxobutanoic acid.
| Compound Name | (2S)-4-[[(5S)-5-amino-6-oxohexyl]amino]-2-naphthalen-2-ylsulfanyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 137349191 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (2S)-4-[[(5S)-5-amino-6-oxohexyl]amino]-2-naphthalen-2-ylsulfanyl-4-oxobutanoic acid |
| SMILES | N[C@H](C=O)CCCCNC(=O)CC(Sc1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C20H24N2O4S/c21-16(13-23)7-3-4-10-22-19(24)12-18(20(25)26)27-17-9-8-14-5-1-2-6-15(14)11-17/h1-2,5-6,8-9,11,13,16,18H,3-4,7,10,12,21H2,(H,22,24)(H,25,26)/t16-,18?/m0/s1 |
| InChIKey | QTMVJIQLLCUJNO-ATNAJCNCSA-N |
| XLogP | 2.59 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|