C26H23N3O2 — CID 137349209
(5aS,6S,8S,9aS)-2-benzoyl-6-methyl-7-oxo-9a-phenyl-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 137349209) has the molecular formula C26H23N3O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is (5aS,6S,8S,9aS)-2-benzoyl-6-methyl-7-oxo-9a-phenyl-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (5aS,6S,8S,9aS)-2-benzoyl-6-methyl-7-oxo-9a-phenyl-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 137349209 |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (5aS,6S,8S,9aS)-2-benzoyl-6-methyl-7-oxo-9a-phenyl-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | C[C@@H]1C(=O)[C@H](C#N)C[C@]2(c3ccccc3)c3nn(C(=O)c4ccccc4)cc3CC[C@@H]12 |
| InChI | InChI=1S/C26H23N3O2/c1-17-22-13-12-19-16-29(25(31)18-8-4-2-5-9-18)28-24(19)26(22,14-20(15-27)23(17)30)21-10-6-3-7-11-21/h2-11,16-17,20,22H,12-14H2,1H3/t17-,20-,22-,26+/m0/s1 |
| InChIKey | NFNOOTFITPQOPV-OVTRCYTESA-N |
| XLogP | 4.17 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|