C12H21N2O6P2-3 — CID 137349403
[2-(3-heptylimidazol-1-ium-1-yl)-1-phosphonatoethyl]-dioxido-oxo-λ5-phosphane (PubChem CID 137349403) has the molecular formula C12H21N2O6P2-3 and a molecular weight of 351.26 g/mol. Its IUPAC name is [2-(3-heptylimidazol-1-ium-1-yl)-1-phosphonatoethyl]-dioxido-oxo-λ5-phosphane.
| Compound Name | [2-(3-heptylimidazol-1-ium-1-yl)-1-phosphonatoethyl]-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 137349403 |
| Molecular Formula | C12H21N2O6P2-3 |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | [2-(3-heptylimidazol-1-ium-1-yl)-1-phosphonatoethyl]-dioxido-oxo-λ5-phosphane |
| SMILES | CCCCCCCn1cc[n+](CC(P(=O)([O-])[O-])P(=O)([O-])[O-])c1 |
| InChI | InChI=1S/C12H24N2O6P2/c1-2-3-4-5-6-7-13-8-9-14(11-13)10-12(21(15,16)17)22(18,19)20/h8-9,11-12H,2-7,10H2,1H3,(H3-,15,16,17,18,19,20)/p-3 |
| InChIKey | GQXQNORVSDKRHM-UHFFFAOYSA-K |
| XLogP | -1.10 |
| TPSA | 135.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|