C15H22N3O9P — CID 137349883
(2S,6S)-2-amino-6-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]heptanedioic acid (PubChem CID 137349883) has the molecular formula C15H22N3O9P and a molecular weight of 419.33 g/mol. Its IUPAC name is (2S,6S)-2-amino-6-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]heptanedioic acid.
| Compound Name | (2S,6S)-2-amino-6-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]heptanedioic acid |
|---|---|
| PubChem CID | 137349883 |
| Molecular Formula | C15H22N3O9P |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (2S,6S)-2-amino-6-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]methylideneamino]heptanedioic acid |
| SMILES | Cc1ncc(COP(=O)(O)O)c(/C=N/[C@@H](CCC[C@H](N)C(=O)O)C(=O)O)c1O |
| InChI | InChI=1S/C15H22N3O9P/c1-8-13(19)10(9(5-17-8)7-27-28(24,25)26)6-18-12(15(22)23)4-2-3-11(16)14(20)21/h5-6,11-12,19H,2-4,7,16H2,1H3,(H,20,21)(H,22,23)(H2,24,25,26)/b18-6+/t11-,12-/m0/s1 |
| InChIKey | VHNMKXLQZMEZSG-NTQSYZAISA-N |
| XLogP | 0.16 |
| TPSA | 212.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|