About 2-pyridin-4-yl-4-[(3R)-3-(trifluoromethyl)piperazin-1-yl]-1,7-naphthyridine
2-pyridin-4-yl-4-[(3R)-3-(trifluoromethyl)piperazin-1-yl]-1,7-naphthyridine (PubChem CID 137350719) has the molecular formula C18H16F3N5
and a molecular weight of 359.36 g/mol. Its IUPAC name is 2-pyridin-4-yl-4-[(3R)-3-(trifluoromethyl)piperazin-1-yl]-1,7-naphthyridine.
Molecular Properties
| Compound Name | 2-pyridin-4-yl-4-[(3R)-3-(trifluoromethyl)piperazin-1-yl]-1,7-naphthyridine |
| PubChem CID | 137350719 |
| Molecular Formula | C18H16F3N5 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-pyridin-4-yl-4-[(3R)-3-(trifluoromethyl)piperazin-1-yl]-1,7-naphthyridine |
| SMILES | FC(F)(F)[C@H]1CN(c2cc(-c3ccncc3)nc3cnccc23)CCN1 |
| InChI | InChI=1S/C18H16F3N5/c19-18(20,21)17-11-26(8-7-24-17)16-9-14(12-1-4-22-5-2-12)25-15-10-23-6-3-13(15)16/h1-6,9-10,17,24H,7-8,11H2/t17-/m1/s1 |
| InChIKey | WLQOOSNLZFGHFK-QGZVFWFLSA-N |
| XLogP | 3.03 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-pyridin-4-yl-4-[(3R)-3-(trifluoromethyl)piperazin-1-yl]-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-4-yl-4-[(3R)-3-(trifluoromethyl)piperazin-1-yl]-1,7-naphthyridine?
The IUPAC name of 2-pyridin-4-yl-4-[(3R)-3-(trifluoromethyl)piperazin-1-yl]-1,7-naphthyridine (CID 137350719) is 2-pyridin-4-yl-4-[(3R)-3-(trifluoromethyl)piperazin-1-yl]-1,7-naphthyridine.
What is the SMILES notation for 2-pyridin-4-yl-4-[(3R)-3-(trifluoromethyl)piperazin-1-yl]-1,7-naphthyridine?
The canonical SMILES for 2-pyridin-4-yl-4-[(3R)-3-(trifluoromethyl)piperazin-1-yl]-1,7-naphthyridine is FC(F)(F)[C@H]1CN(c2cc(-c3ccncc3)nc3cnccc23)CCN1.
What is the InChIKey of 2-pyridin-4-yl-4-[(3R)-3-(trifluoromethyl)piperazin-1-yl]-1,7-naphthyridine?
The InChIKey is WLQOOSNLZFGHFK-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H16F3N5/c19-18(20,21)17-11-26(8-7-24-17)16-9-14(12-1-4-22-5-2-12)25-15-10-23-6-3-13(15)16/h1-6,9-10,17,24H,7-8,11H2/t17-/m1/s1.
What are the key properties of 2-pyridin-4-yl-4-[(3R)-3-(trifluoromethyl)piperazin-1-yl]-1,7-naphthyridine?
2-pyridin-4-yl-4-[(3R)-3-(trifluoromethyl)piperazin-1-yl]-1,7-naphthyridine has a molecular weight of 359.36 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-4-yl-4-[(3R)-3-(trifluoromethyl)piperazin-1-yl]-1,7-naphthyridine is sourced from PubChem (CID 137350719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).