About 5-[(2R,6R)-6-(hydroxymethyl)piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one
5-[(2R,6R)-6-(hydroxymethyl)piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one (PubChem CID 137351197) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-[(2R,6R)-6-(hydroxymethyl)piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 5-[(2R,6R)-6-(hydroxymethyl)piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one |
| PubChem CID | 137351197 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 5-[(2R,6R)-6-(hydroxymethyl)piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one |
| SMILES | Cc1c([C@@H]2CNC[C@H](CO)N2)ccc2c1COC2=O |
| InChI | InChI=1S/C14H18N2O3/c1-8-10(13-5-15-4-9(6-17)16-13)2-3-11-12(8)7-19-14(11)18/h2-3,9,13,15-17H,4-7H2,1H3/t9-,13+/m1/s1 |
| InChIKey | WYVMVHFZPAVCAN-RNCFNFMXSA-N |
| XLogP | 0.26 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2R,6R)-6-(hydroxymethyl)piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2R,6R)-6-(hydroxymethyl)piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one?
The IUPAC name of 5-[(2R,6R)-6-(hydroxymethyl)piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one (CID 137351197) is 5-[(2R,6R)-6-(hydroxymethyl)piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one.
What is the SMILES notation for 5-[(2R,6R)-6-(hydroxymethyl)piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one?
The canonical SMILES for 5-[(2R,6R)-6-(hydroxymethyl)piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one is Cc1c([C@@H]2CNC[C@H](CO)N2)ccc2c1COC2=O.
What is the InChIKey of 5-[(2R,6R)-6-(hydroxymethyl)piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one?
The InChIKey is WYVMVHFZPAVCAN-RNCFNFMXSA-N. The full InChI is InChI=1S/C14H18N2O3/c1-8-10(13-5-15-4-9(6-17)16-13)2-3-11-12(8)7-19-14(11)18/h2-3,9,13,15-17H,4-7H2,1H3/t9-,13+/m1/s1.
What are the key properties of 5-[(2R,6R)-6-(hydroxymethyl)piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one?
5-[(2R,6R)-6-(hydroxymethyl)piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one has a molecular weight of 262.31 g/mol, XLogP of 0.26, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2R,6R)-6-(hydroxymethyl)piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one is sourced from PubChem (CID 137351197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).