About [1-(4-bromophenyl)-2,2,2-trifluoroethyl]-(1-naphthalen-1-ylethyl)carbamic acid
[1-(4-bromophenyl)-2,2,2-trifluoroethyl]-(1-naphthalen-1-ylethyl)carbamic acid (PubChem CID 137351355) has the molecular formula C21H17BrF3NO2
and a molecular weight of 452.27 g/mol. Its IUPAC name is [1-(4-bromophenyl)-2,2,2-trifluoroethyl]-(1-naphthalen-1-ylethyl)carbamic acid.
Molecular Properties
| Compound Name | [1-(4-bromophenyl)-2,2,2-trifluoroethyl]-(1-naphthalen-1-ylethyl)carbamic acid |
| PubChem CID | 137351355 |
| Molecular Formula | C21H17BrF3NO2 |
| Molecular Weight | 452.27 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | [1-(4-bromophenyl)-2,2,2-trifluoroethyl]-(1-naphthalen-1-ylethyl)carbamic acid |
| SMILES | CC(c1cccc2ccccc12)N(C(=O)O)C(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H17BrF3NO2/c1-13(17-8-4-6-14-5-2-3-7-18(14)17)26(20(27)28)19(21(23,24)25)15-9-11-16(22)12-10-15/h2-13,19H,1H3,(H,27,28) |
| InChIKey | FOIPQICZAXKWNZ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.27 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [1-(4-bromophenyl)-2,2,2-trifluoroethyl]-(1-naphthalen-1-ylethyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-bromophenyl)-2,2,2-trifluoroethyl]-(1-naphthalen-1-ylethyl)carbamic acid?
The IUPAC name of [1-(4-bromophenyl)-2,2,2-trifluoroethyl]-(1-naphthalen-1-ylethyl)carbamic acid (CID 137351355) is [1-(4-bromophenyl)-2,2,2-trifluoroethyl]-(1-naphthalen-1-ylethyl)carbamic acid.
What is the SMILES notation for [1-(4-bromophenyl)-2,2,2-trifluoroethyl]-(1-naphthalen-1-ylethyl)carbamic acid?
The canonical SMILES for [1-(4-bromophenyl)-2,2,2-trifluoroethyl]-(1-naphthalen-1-ylethyl)carbamic acid is CC(c1cccc2ccccc12)N(C(=O)O)C(c1ccc(Br)cc1)C(F)(F)F.
What is the InChIKey of [1-(4-bromophenyl)-2,2,2-trifluoroethyl]-(1-naphthalen-1-ylethyl)carbamic acid?
The InChIKey is FOIPQICZAXKWNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17BrF3NO2/c1-13(17-8-4-6-14-5-2-3-7-18(14)17)26(20(27)28)19(21(23,24)25)15-9-11-16(22)12-10-15/h2-13,19H,1H3,(H,27,28).
What are the key properties of [1-(4-bromophenyl)-2,2,2-trifluoroethyl]-(1-naphthalen-1-ylethyl)carbamic acid?
[1-(4-bromophenyl)-2,2,2-trifluoroethyl]-(1-naphthalen-1-ylethyl)carbamic acid has a molecular weight of 452.27 g/mol, XLogP of 6.95, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-bromophenyl)-2,2,2-trifluoroethyl]-(1-naphthalen-1-ylethyl)carbamic acid is sourced from PubChem (CID 137351355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).