C20H21N2O3S- — CID 137351469
[3-(2-methyl-6-oxo-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-8-yl)phenyl]methanesulfinate (PubChem CID 137351469) has the molecular formula C20H21N2O3S- and a molecular weight of 369.47 g/mol. Its IUPAC name is [3-(2-methyl-6-oxo-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-8-yl)phenyl]methanesulfinate.
| Compound Name | [3-(2-methyl-6-oxo-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-8-yl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 137351469 |
| Molecular Formula | C20H21N2O3S- |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | [3-(2-methyl-6-oxo-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-8-yl)phenyl]methanesulfinate |
| SMILES | CN1CC2CNC(=O)c3cc(-c4cccc(CS(=O)[O-])c4)ccc3C2C1 |
| InChI | InChI=1S/C20H22N2O3S/c1-22-10-16-9-21-20(23)18-8-15(5-6-17(18)19(16)11-22)14-4-2-3-13(7-14)12-26(24)25/h2-8,16,19H,9-12H2,1H3,(H,21,23)(H,24,25)/p-1 |
| InChIKey | LRHLYZJBPLUXCD-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|