C22H20FN5 — CID 137351567
2-(4-fluorophenyl)-3-([1,2,4]triazolo[1,5-a]pyridin-6-yl)spiro[5,7-dihydropyrrolo[1,2-a]imidazole-6,1'-cyclopentane] (PubChem CID 137351567) has the molecular formula C22H20FN5 and a molecular weight of 373.44 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-([1,2,4]triazolo[1,5-a]pyridin-6-yl)spiro[5,7-dihydropyrrolo[1,2-a]imidazole-6,1'-cyclopentane].
| Compound Name | 2-(4-fluorophenyl)-3-([1,2,4]triazolo[1,5-a]pyridin-6-yl)spiro[5,7-dihydropyrrolo[1,2-a]imidazole-6,1'-cyclopentane] |
|---|---|
| PubChem CID | 137351567 |
| Molecular Formula | C22H20FN5 |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2-(4-fluorophenyl)-3-([1,2,4]triazolo[1,5-a]pyridin-6-yl)spiro[5,7-dihydropyrrolo[1,2-a]imidazole-6,1'-cyclopentane] |
| SMILES | Fc1ccc(-c2nc3n(c2-c2ccc4ncnn4c2)CC2(CCCC2)C3)cc1 |
| InChI | InChI=1S/C22H20FN5/c23-17-6-3-15(4-7-17)20-21(16-5-8-18-24-14-25-28(18)12-16)27-13-22(9-1-2-10-22)11-19(27)26-20/h3-8,12,14H,1-2,9-11,13H2 |
| InChIKey | QGJFFTNRIZVJTG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |