C30H32F4N4O — CID 137352668
1-[2-(2,6-diethylphenyl)-3-(7-fluoro-1H-indol-4-yl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-5-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-one (PubChem CID 137352668) has the molecular formula C30H32F4N4O and a molecular weight of 540.61 g/mol. Its IUPAC name is 1-[2-(2,6-diethylphenyl)-3-(7-fluoro-1H-indol-4-yl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-5-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-one.
| Compound Name | 1-[2-(2,6-diethylphenyl)-3-(7-fluoro-1H-indol-4-yl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-5-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 137352668 |
| Molecular Formula | C30H32F4N4O |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 1-[2-(2,6-diethylphenyl)-3-(7-fluoro-1H-indol-4-yl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-5-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-one |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1ccc(F)c3[nH]ccc13)CN(C(=O)C(C)(C)C(F)(F)F)C2(C)C |
| InChI | InChI=1S/C30H32F4N4O/c1-7-17-10-9-11-18(8-2)24(17)38-25(20-12-13-22(31)23-19(20)14-15-35-23)21-16-37(29(5,6)26(21)36-38)27(39)28(3,4)30(32,33)34/h9-15,35H,7-8,16H2,1-6H3 |
| InChIKey | YEWWNMQKAQXUEH-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |