About (2-amino-3-methylbutyl) 2-bromobenzoate
(2-amino-3-methylbutyl) 2-bromobenzoate (PubChem CID 137352717) has the molecular formula C12H16BrNO2
and a molecular weight of 286.17 g/mol. Its IUPAC name is (2-amino-3-methylbutyl) 2-bromobenzoate.
Molecular Properties
| Compound Name | (2-amino-3-methylbutyl) 2-bromobenzoate |
| PubChem CID | 137352717 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | (2-amino-3-methylbutyl) 2-bromobenzoate |
| SMILES | CC(C)C(N)COC(=O)c1ccccc1Br |
| InChI | InChI=1S/C12H16BrNO2/c1-8(2)11(14)7-16-12(15)9-5-3-4-6-10(9)13/h3-6,8,11H,7,14H2,1-2H3 |
| InChIKey | XWORSYUTXMDOKZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-amino-3-methylbutyl) 2-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-3-methylbutyl) 2-bromobenzoate?
The IUPAC name of (2-amino-3-methylbutyl) 2-bromobenzoate (CID 137352717) is (2-amino-3-methylbutyl) 2-bromobenzoate.
What is the SMILES notation for (2-amino-3-methylbutyl) 2-bromobenzoate?
The canonical SMILES for (2-amino-3-methylbutyl) 2-bromobenzoate is CC(C)C(N)COC(=O)c1ccccc1Br.
What is the InChIKey of (2-amino-3-methylbutyl) 2-bromobenzoate?
The InChIKey is XWORSYUTXMDOKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNO2/c1-8(2)11(14)7-16-12(15)9-5-3-4-6-10(9)13/h3-6,8,11H,7,14H2,1-2H3.
What are the key properties of (2-amino-3-methylbutyl) 2-bromobenzoate?
(2-amino-3-methylbutyl) 2-bromobenzoate has a molecular weight of 286.17 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-3-methylbutyl) 2-bromobenzoate is sourced from PubChem (CID 137352717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).