C26H19N5O2S — CID 137353183
2-[5-[2-(6-amino-3-pyridinyl)ethynyl]-3-oxo-1H-isoindol-2-yl]-2-phenyl-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 137353183) has the molecular formula C26H19N5O2S and a molecular weight of 465.54 g/mol. Its IUPAC name is 2-[5-[2-(6-amino-3-pyridinyl)ethynyl]-3-oxo-1H-isoindol-2-yl]-2-phenyl-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[5-[2-(6-amino-3-pyridinyl)ethynyl]-3-oxo-1H-isoindol-2-yl]-2-phenyl-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 137353183 |
| Molecular Formula | C26H19N5O2S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 2-[5-[2-(6-amino-3-pyridinyl)ethynyl]-3-oxo-1H-isoindol-2-yl]-2-phenyl-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | Nc1ccc(C#Cc2ccc3c(c2)C(=O)N(C(C(=O)Nc2nccs2)c2ccccc2)C3)cn1 |
| InChI | InChI=1S/C26H19N5O2S/c27-22-11-9-18(15-29-22)7-6-17-8-10-20-16-31(25(33)21(20)14-17)23(19-4-2-1-3-5-19)24(32)30-26-28-12-13-34-26/h1-5,8-15,23H,16H2,(H2,27,29)(H,28,30,32) |
| InChIKey | FCFLHDKAUYOIDL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|