C20H16ClN3OS — CID 1373542
N-(3-chloro-4-methylphenyl)-2-(3-cyano-6-methylquinolin-2-yl)sulfanylacetamide (PubChem CID 1373542) has the molecular formula C20H16ClN3OS and a molecular weight of 381.89 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-(3-cyano-6-methylquinolin-2-yl)sulfanylacetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-(3-cyano-6-methylquinolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 1373542 |
| Molecular Formula | C20H16ClN3OS |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-(3-cyano-6-methylquinolin-2-yl)sulfanylacetamide |
| SMILES | Cc1ccc2nc(SCC(=O)Nc3ccc(C)c(Cl)c3)c(C#N)cc2c1 |
| InChI | InChI=1S/C20H16ClN3OS/c1-12-3-6-18-14(7-12)8-15(10-22)20(24-18)26-11-19(25)23-16-5-4-13(2)17(21)9-16/h3-9H,11H2,1-2H3,(H,23,25) |
| InChIKey | WVBCIIJUINFTLH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |