C18H16F3N3O2 — CID 137354206
N-[(6S)-6-amino-1-formyl-5,6,7,8-tetrahydronaphthalen-2-yl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 137354206) has the molecular formula C18H16F3N3O2 and a molecular weight of 363.34 g/mol. Its IUPAC name is N-[(6S)-6-amino-1-formyl-5,6,7,8-tetrahydronaphthalen-2-yl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[(6S)-6-amino-1-formyl-5,6,7,8-tetrahydronaphthalen-2-yl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 137354206 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[(6S)-6-amino-1-formyl-5,6,7,8-tetrahydronaphthalen-2-yl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | N[C@H]1CCc2c(ccc(NC(=O)c3ccc(C(F)(F)F)nc3)c2C=O)C1 |
| InChI | InChI=1S/C18H16F3N3O2/c19-18(20,21)16-6-2-11(8-23-16)17(26)24-15-5-1-10-7-12(22)3-4-13(10)14(15)9-25/h1-2,5-6,8-9,12H,3-4,7,22H2,(H,24,26)/t12-/m0/s1 |
| InChIKey | BVTIJLUJKFHKID-LBPRGKRZSA-N |
| XLogP | 2.98 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|