C23H28N6O2 — CID 137354362
[(1S,4R)-4-[[3-[(2R)-1,2-dimethylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea (PubChem CID 137354362) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is [(1S,4R)-4-[[3-[(2R)-1,2-dimethylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea.
| Compound Name | [(1S,4R)-4-[[3-[(2R)-1,2-dimethylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
|---|---|
| PubChem CID | 137354362 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | [(1S,4R)-4-[[3-[(2R)-1,2-dimethylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
| SMILES | CN1CCC[C@]1(C)c1nnc2ccc(O[C@@H]3CC[C@H](NC(N)=O)c4ccccc43)cn12 |
| InChI | InChI=1S/C23H28N6O2/c1-23(12-5-13-28(23)2)21-27-26-20-11-8-15(14-29(20)21)31-19-10-9-18(25-22(24)30)16-6-3-4-7-17(16)19/h3-4,6-8,11,14,18-19H,5,9-10,12-13H2,1-2H3,(H3,24,25,30)/t18-,19+,23+/m0/s1 |
| InChIKey | PPGMZSHXTOKLGD-YCRNBWNJSA-N |
| XLogP | 3.29 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |