C25H34FNO2 — CID 137355109
N,N-diethyl-3-[(13S,15R)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanamide (PubChem CID 137355109) has the molecular formula C25H34FNO2 and a molecular weight of 399.55 g/mol. Its IUPAC name is N,N-diethyl-3-[(13S,15R)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanamide.
| Compound Name | N,N-diethyl-3-[(13S,15R)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanamide |
|---|---|
| PubChem CID | 137355109 |
| Molecular Formula | C25H34FNO2 |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | N,N-diethyl-3-[(13S,15R)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanamide |
| SMILES | CCN(CC)C(=O)CCC1CC(=O)[C@@]2(C)CCC3c4cccc(F)c4CCC3C12 |
| InChI | InChI=1S/C25H34FNO2/c1-4-27(5-2)23(29)12-9-16-15-22(28)25(3)14-13-18-17-7-6-8-21(26)19(17)10-11-20(18)24(16)25/h6-8,16,18,20,24H,4-5,9-15H2,1-3H3/t16?,18?,20?,24?,25-/m1/s1 |
| InChIKey | UJFKGAWHOUMJAF-JZWHDXGGSA-N |
| XLogP | 5.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |