cis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid

C9H10N2O2 — CID 137356340

IUPACcis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid
SMILESO=C(O)[C@H]1CC[C@H]1c1ncccn1
InChIInChI=1S/C9H10N2O2/c12-9(13)7-3-2-6(7)8-10-4-1-5-11-8/h1,4-7H,2-3H2,(H,12,13)/t6-,7+/m1/s1
InChIKeyVPSGXFPPKNUSIN-RQJHMYQMSA-N
MW178.19 g/mol
LogP1.05
Rot. Bonds2

About cis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid

cis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid (PubChem CID 137356340) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is cis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid.

Molecular Properties

Compound Namecis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid
PubChem CID137356340
Molecular FormulaC9H10N2O2
Molecular Weight178.19 g/mol
Exact Mass178.07
IUPAC Namecis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid
SMILESO=C(O)[C@H]1CC[C@H]1c1ncccn1
InChIInChI=1S/C9H10N2O2/c12-9(13)7-3-2-6(7)8-10-4-1-5-11-8/h1,4-7H,2-3H2,(H,12,13)/t6-,7+/m1/s1
InChIKeyVPSGXFPPKNUSIN-RQJHMYQMSA-N
XLogP1.05
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.19
LogP ≤ 51.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze cis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid?
The IUPAC name of cis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid (CID 137356340) is cis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid.
What is the SMILES notation for cis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid?
The canonical SMILES for cis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid is O=C(O)[C@H]1CC[C@H]1c1ncccn1.
What is the InChIKey of cis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid?
The InChIKey is VPSGXFPPKNUSIN-RQJHMYQMSA-N. The full InChI is InChI=1S/C9H10N2O2/c12-9(13)7-3-2-6(7)8-10-4-1-5-11-8/h1,4-7H,2-3H2,(H,12,13)/t6-,7+/m1/s1.
What are the key properties of cis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid?
cis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid has a molecular weight of 178.19 g/mol, XLogP of 1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-2-pyrimidin-2-ylcyclobutane-1-carboxylic acid is sourced from PubChem (CID 137356340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).