C24H24ClFN6O2 — CID 137357498
methyl 8-chloro-1-[2-(5-fluoro-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-4-methyl-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate (PubChem CID 137357498) has the molecular formula C24H24ClFN6O2 and a molecular weight of 482.95 g/mol. Its IUPAC name is methyl 8-chloro-1-[2-(5-fluoro-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-4-methyl-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate.
| Compound Name | methyl 8-chloro-1-[2-(5-fluoro-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-4-methyl-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 137357498 |
| Molecular Formula | C24H24ClFN6O2 |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | methyl 8-chloro-1-[2-(5-fluoro-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-4-methyl-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate |
| SMILES | COC(=O)N1Cc2cc(Cl)ccc2-n2c(C3CC4(C3)CN(c3ccc(F)cn3)C4)nnc2C1C |
| InChI | InChI=1S/C24H24ClFN6O2/c1-14-21-28-29-22(16-8-24(9-16)12-30(13-24)20-6-4-18(26)10-27-20)32(21)19-5-3-17(25)7-15(19)11-31(14)23(33)34-2/h3-7,10,14,16H,8-9,11-13H2,1-2H3 |
| InChIKey | BWZDFVXMWSTRJX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |