C11H12N4O7S — CID 137357720
[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 137357720) has the molecular formula C11H12N4O7S and a molecular weight of 344.31 g/mol. Its IUPAC name is [2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 137357720 |
| Molecular Formula | C11H12N4O7S |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | [2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1CN(c2cnc3c(n2)NC(=O)CO3)C(=O)O1 |
| InChI | InChI=1S/C11H12N4O7S/c1-23(18,19)21-4-6-3-15(11(17)22-6)7-2-12-10-9(13-7)14-8(16)5-20-10/h2,6H,3-5H2,1H3,(H,13,14,16) |
| InChIKey | JEVSTLUXUSDWLL-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|