C12H14N4O7S — CID 137357762
2-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethyl methanesulfonate (PubChem CID 137357762) has the molecular formula C12H14N4O7S and a molecular weight of 358.33 g/mol. Its IUPAC name is 2-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethyl methanesulfonate.
| Compound Name | 2-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 137357762 |
| Molecular Formula | C12H14N4O7S |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCC1CN(c2cnc3c(n2)NC(=O)CO3)C(=O)O1 |
| InChI | InChI=1S/C12H14N4O7S/c1-24(19,20)22-3-2-7-5-16(12(18)23-7)8-4-13-11-10(14-8)15-9(17)6-21-11/h4,7H,2-3,5-6H2,1H3,(H,14,15,17) |
| InChIKey | VWKKBJOMGJLRDZ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|