C23H24N6O2S2 — CID 137358382
N-[4-[(3R)-3-[[5-(pyrimidin-5-ylmethylsulfanyl)-1,3-thiazol-2-yl]amino]piperidine-1-carbonyl]phenyl]prop-2-enamide (PubChem CID 137358382) has the molecular formula C23H24N6O2S2 and a molecular weight of 480.62 g/mol. Its IUPAC name is N-[4-[(3R)-3-[[5-(pyrimidin-5-ylmethylsulfanyl)-1,3-thiazol-2-yl]amino]piperidine-1-carbonyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[(3R)-3-[[5-(pyrimidin-5-ylmethylsulfanyl)-1,3-thiazol-2-yl]amino]piperidine-1-carbonyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 137358382 |
| Molecular Formula | C23H24N6O2S2 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | N-[4-[(3R)-3-[[5-(pyrimidin-5-ylmethylsulfanyl)-1,3-thiazol-2-yl]amino]piperidine-1-carbonyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(C(=O)N2CCC[C@@H](Nc3ncc(SCc4cncnc4)s3)C2)cc1 |
| InChI | InChI=1S/C23H24N6O2S2/c1-2-20(30)27-18-7-5-17(6-8-18)22(31)29-9-3-4-19(13-29)28-23-26-12-21(33-23)32-14-16-10-24-15-25-11-16/h2,5-8,10-12,15,19H,1,3-4,9,13-14H2,(H,26,28)(H,27,30)/t19-/m1/s1 |
| InChIKey | XUDADWUSJUXKJW-LJQANCHMSA-N |
| XLogP | 4.07 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|