C25H28F2N6O2 — CID 137360205
2-[(3R)-1-(2,2-difluoroethyl)piperidin-3-yl]-N-[(2,4-dimethoxyphenyl)methyl]-[1,2,4]triazolo[1,5-c]quinazolin-5-amine (PubChem CID 137360205) has the molecular formula C25H28F2N6O2 and a molecular weight of 482.54 g/mol. Its IUPAC name is 2-[(3R)-1-(2,2-difluoroethyl)piperidin-3-yl]-N-[(2,4-dimethoxyphenyl)methyl]-[1,2,4]triazolo[1,5-c]quinazolin-5-amine.
| Compound Name | 2-[(3R)-1-(2,2-difluoroethyl)piperidin-3-yl]-N-[(2,4-dimethoxyphenyl)methyl]-[1,2,4]triazolo[1,5-c]quinazolin-5-amine |
|---|---|
| PubChem CID | 137360205 |
| Molecular Formula | C25H28F2N6O2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 2-[(3R)-1-(2,2-difluoroethyl)piperidin-3-yl]-N-[(2,4-dimethoxyphenyl)methyl]-[1,2,4]triazolo[1,5-c]quinazolin-5-amine |
| SMILES | COc1ccc(CNc2nc3ccccc3c3nc([C@@H]4CCCN(CC(F)F)C4)nn23)c(OC)c1 |
| InChI | InChI=1S/C25H28F2N6O2/c1-34-18-10-9-16(21(12-18)35-2)13-28-25-29-20-8-4-3-7-19(20)24-30-23(31-33(24)25)17-6-5-11-32(14-17)15-22(26)27/h3-4,7-10,12,17,22H,5-6,11,13-15H2,1-2H3,(H,28,29)/t17-/m1/s1 |
| InChIKey | QPZSRBOMNCJPDS-QGZVFWFLSA-N |
| XLogP | 4.35 |
| TPSA | 76.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |