C33H41FN3O10P — CID 137361576
[3-ethoxy-5-[5-[[2-[1-[(2-fluoro-6-methylbenzoyl)oxy-formylamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid (PubChem CID 137361576) has the molecular formula C33H41FN3O10P and a molecular weight of 689.67 g/mol. Its IUPAC name is [3-ethoxy-5-[5-[[2-[1-[(2-fluoro-6-methylbenzoyl)oxy-formylamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid.
| Compound Name | [3-ethoxy-5-[5-[[2-[1-[(2-fluoro-6-methylbenzoyl)oxy-formylamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 137361576 |
| Molecular Formula | C33H41FN3O10P |
| Molecular Weight | 689.67 g/mol |
| Exact Mass | 689.25 |
| IUPAC Name | [3-ethoxy-5-[5-[[2-[1-[(2-fluoro-6-methylbenzoyl)oxy-formylamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(P(=O)(O)O)c2)o1)C(CC)N(C=O)OC(=O)c1c(C)cccc1F |
| InChI | InChI=1S/C33H41FN3O10P/c1-5-8-9-12-25(27(6-2)37(20-38)47-33(41)30-21(4)11-10-13-26(30)34)31(39)35-19-36-32(40)29-15-14-28(46-29)22-16-23(45-7-3)18-24(17-22)48(42,43)44/h10-11,13-18,20,25,27H,5-9,12,19H2,1-4H3,(H,35,39)(H,36,40)(H2,42,43,44) |
| InChIKey | MFZGUIPZCOVDSG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 184.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.67 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|